C25H40N9O2+ — CID 159763116
1,6-ditert-butylpyrazolo[4,5-d]pyridazin-7-one;2,7-ditert-butyl-3H-pyrazolo[5,4-d]triazin-2-ium-4-one (PubChem CID 159763116) has the molecular formula C25H40N9O2+ and a molecular weight of 498.66 g/mol. Its IUPAC name is 1,6-ditert-butylpyrazolo[4,5-d]pyridazin-7-one;2,7-ditert-butyl-3H-pyrazolo[5,4-d]triazin-2-ium-4-one.
| Compound Name | 1,6-ditert-butylpyrazolo[4,5-d]pyridazin-7-one;2,7-ditert-butyl-3H-pyrazolo[5,4-d]triazin-2-ium-4-one |
|---|---|
| PubChem CID | 159763116 |
| Molecular Formula | C25H40N9O2+ |
| Molecular Weight | 498.66 g/mol |
| Exact Mass | 498.33 |
| IUPAC Name | 1,6-ditert-butylpyrazolo[4,5-d]pyridazin-7-one;2,7-ditert-butyl-3H-pyrazolo[5,4-d]triazin-2-ium-4-one |
| SMILES | CC(C)(C)n1ncc2c(=O)[nH][n+](C(C)(C)C)nc21.CC(C)(C)n1ncc2cnn(C(C)(C)C)c2c1=O |
| InChI | InChI=1S/C13H20N4O.C12H19N5O/c1-12(2,3)16-10-9(7-14-16)8-15-17(11(10)18)13(4,5)6;1-11(2,3)16-9-8(7-13-16)10(18)15-17(14-9)12(4,5)6/h7-8H,1-6H3;7H,1-6H3/p+1 |
| InChIKey | CWTDIBJZSQPXGB-UHFFFAOYSA-O |
| XLogP | 3.02 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.66 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|