C25H24Br2O10 — CID 159763206
4-(bromomethyl)-2-hydroxybenzaldehyde;dimethyl propanedioate;methyl 7-(bromomethyl)-2-oxochromene-3-carboxylate (PubChem CID 159763206) has the molecular formula C25H24Br2O10 and a molecular weight of 644.27 g/mol. Its IUPAC name is 4-(bromomethyl)-2-hydroxybenzaldehyde;dimethyl propanedioate;methyl 7-(bromomethyl)-2-oxochromene-3-carboxylate.
| Compound Name | 4-(bromomethyl)-2-hydroxybenzaldehyde;dimethyl propanedioate;methyl 7-(bromomethyl)-2-oxochromene-3-carboxylate |
|---|---|
| PubChem CID | 159763206 |
| Molecular Formula | C25H24Br2O10 |
| Molecular Weight | 644.27 g/mol |
| Exact Mass | 641.97 |
| IUPAC Name | 4-(bromomethyl)-2-hydroxybenzaldehyde;dimethyl propanedioate;methyl 7-(bromomethyl)-2-oxochromene-3-carboxylate |
| SMILES | COC(=O)CC(=O)OC.COC(=O)c1cc2ccc(CBr)cc2oc1=O.O=Cc1ccc(CBr)cc1O |
| InChI | InChI=1S/C12H9BrO4.C8H7BrO2.C5H8O4/c1-16-11(14)9-5-8-3-2-7(6-13)4-10(8)17-12(9)15;9-4-6-1-2-7(5-10)8(11)3-6;1-8-4(6)3-5(7)9-2/h2-5H,6H2,1H3;1-3,5,11H,4H2;3H2,1-2H3 |
| InChIKey | NFDXEDYYZWLTLS-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 146.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.27 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|