About 2-bromoethanol;2-(2-methylpyrrolidin-1-yl)ethanol
2-bromoethanol;2-(2-methylpyrrolidin-1-yl)ethanol (PubChem CID 159765495) has the molecular formula C9H20BrNO2
and a molecular weight of 254.17 g/mol. Its IUPAC name is 2-bromoethanol;2-(2-methylpyrrolidin-1-yl)ethanol.
Molecular Properties
| Compound Name | 2-bromoethanol;2-(2-methylpyrrolidin-1-yl)ethanol |
| PubChem CID | 159765495 |
| Molecular Formula | C9H20BrNO2 |
| Molecular Weight | 254.17 g/mol |
| Exact Mass | 253.07 |
| IUPAC Name | 2-bromoethanol;2-(2-methylpyrrolidin-1-yl)ethanol |
| SMILES | CC1CCCN1CCO.OCCBr |
| InChI | InChI=1S/C7H15NO.C2H5BrO/c1-7-3-2-4-8(7)5-6-9;3-1-2-4/h7,9H,2-6H2,1H3;4H,1-2H2 |
| InChIKey | NFLFABNSUNTTEO-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.17 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromoethanol;2-(2-methylpyrrolidin-1-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromoethanol;2-(2-methylpyrrolidin-1-yl)ethanol?
The IUPAC name of 2-bromoethanol;2-(2-methylpyrrolidin-1-yl)ethanol (CID 159765495) is 2-bromoethanol;2-(2-methylpyrrolidin-1-yl)ethanol.
What is the SMILES notation for 2-bromoethanol;2-(2-methylpyrrolidin-1-yl)ethanol?
The canonical SMILES for 2-bromoethanol;2-(2-methylpyrrolidin-1-yl)ethanol is CC1CCCN1CCO.OCCBr.
What is the InChIKey of 2-bromoethanol;2-(2-methylpyrrolidin-1-yl)ethanol?
The InChIKey is NFLFABNSUNTTEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C2H5BrO/c1-7-3-2-4-8(7)5-6-9;3-1-2-4/h7,9H,2-6H2,1H3;4H,1-2H2.
What are the key properties of 2-bromoethanol;2-(2-methylpyrrolidin-1-yl)ethanol?
2-bromoethanol;2-(2-methylpyrrolidin-1-yl)ethanol has a molecular weight of 254.17 g/mol, XLogP of 0.84, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromoethanol;2-(2-methylpyrrolidin-1-yl)ethanol is sourced from PubChem (CID 159765495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).