About CID 159765874
CID 159765874 (PubChem CID 159765874) has the molecular formula C35H32B3Br2N10O6
and a molecular weight of 880.95 g/mol.
Molecular Properties
| Compound Name | CID 159765874 |
| PubChem CID | 159765874 |
| Molecular Formula | C35H32B3Br2N10O6 |
| Molecular Weight | 880.95 g/mol |
| Exact Mass | 879.12 |
| IUPAC Name | — |
| SMILES | COCc1cccc2[nH]c(-c3nn(C)c4ncc(Br)cc34)nc12.C[B]OOCB=O.[B]C(=O)n1c(-c2nn(C)c3ncc(Br)cc23)nc2c(COC)cccc21 |
| InChI | InChI=1S/C17H13BBrN5O2.C16H14BrN5O.C2H5B2O3/c1-23-15-11(6-10(19)7-20-15)14(22-23)16-21-13-9(8-26-2)4-3-5-12(13)24(16)17(18)25;1-22-16-11(6-10(17)7-18-16)14(21-22)15-19-12-5-3-4-9(8-23-2)13(12)20-15;1-3-7-6-2-4-5/h3-7H,8H2,1-2H3;3-7H,8H2,1-2H3,(H,19,20);2H2,1H3 |
| InChIKey | GKQCMQDULBDXIC-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 178.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 880.95 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 15 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze CID 159765874 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 159765874?
The IUPAC name of CID 159765874 (CID 159765874) is not available.
What is the SMILES notation for CID 159765874?
The canonical SMILES for CID 159765874 is COCc1cccc2[nH]c(-c3nn(C)c4ncc(Br)cc34)nc12.C[B]OOCB=O.[B]C(=O)n1c(-c2nn(C)c3ncc(Br)cc23)nc2c(COC)cccc21.
What is the InChIKey of CID 159765874?
The InChIKey is GKQCMQDULBDXIC-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H13BBrN5O2.C16H14BrN5O.C2H5B2O3/c1-23-15-11(6-10(19)7-20-15)14(22-23)16-21-13-9(8-26-2)4-3-5-12(13)24(16)17(18)25;1-22-16-11(6-10(17)7-18-16)14(21-22)15-19-12-5-3-4-9(8-23-2)13(12)20-15;1-3-7-6-2-4-5/h3-7H,8H2,1-2H3;3-7H,8H2,1-2H3,(H,19,20);2H2,1H3.
What are the key properties of CID 159765874?
CID 159765874 has a molecular weight of 880.95 g/mol, XLogP of 6.06, 10 rotatable bonds, 1 hydrogen bond donors, and 15 hydrogen bond acceptors.
Where does this data come from?
All data for CID 159765874 is sourced from PubChem (CID 159765874), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).