C36H72O12 — CID 159766824
2,2,2-triethoxyethoxycyclobutane (PubChem CID 159766824) has the molecular formula C36H72O12 and a molecular weight of 696.96 g/mol. Its IUPAC name is 2,2,2-triethoxyethoxycyclobutane.
| Compound Name | 2,2,2-triethoxyethoxycyclobutane |
|---|---|
| PubChem CID | 159766824 |
| Molecular Formula | C36H72O12 |
| Molecular Weight | 696.96 g/mol |
| Exact Mass | 696.50 |
| IUPAC Name | 2,2,2-triethoxyethoxycyclobutane |
| SMILES | CCOC(COC1CCC1)(OCC)OCC.CCOC(COC1CCC1)(OCC)OCC.CCOC(COC1CCC1)(OCC)OCC |
| InChI | InChI=1S/3C12H24O4/c3*1-4-14-12(15-5-2,16-6-3)10-13-11-8-7-9-11/h3*11H,4-10H2,1-3H3 |
| InChIKey | NFPMGJHQJJASBH-UHFFFAOYSA-N |
| XLogP | 6.96 |
| TPSA | 110.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.96 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|