About 4-bromo-2-chloro-5-fluorophenol;2-chloro-5-fluorophenol
4-bromo-2-chloro-5-fluorophenol;2-chloro-5-fluorophenol (PubChem CID 159767315) has the molecular formula C12H7BrCl2F2O2
and a molecular weight of 371.99 g/mol. Its IUPAC name is 4-bromo-2-chloro-5-fluorophenol;2-chloro-5-fluorophenol.
Molecular Properties
| Compound Name | 4-bromo-2-chloro-5-fluorophenol;2-chloro-5-fluorophenol |
| PubChem CID | 159767315 |
| Molecular Formula | C12H7BrCl2F2O2 |
| Molecular Weight | 371.99 g/mol |
| Exact Mass | 369.90 |
| IUPAC Name | 4-bromo-2-chloro-5-fluorophenol;2-chloro-5-fluorophenol |
| SMILES | Oc1cc(F)c(Br)cc1Cl.Oc1cc(F)ccc1Cl |
| InChI | InChI=1S/C6H3BrClFO.C6H4ClFO/c7-3-1-4(8)6(10)2-5(3)9;7-5-2-1-4(8)3-6(5)9/h1-2,10H;1-3,9H |
| InChIKey | NFQZCTUGVTTZBH-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.99 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|
Analyze 4-bromo-2-chloro-5-fluorophenol;2-chloro-5-fluorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-chloro-5-fluorophenol;2-chloro-5-fluorophenol?
The IUPAC name of 4-bromo-2-chloro-5-fluorophenol;2-chloro-5-fluorophenol (CID 159767315) is 4-bromo-2-chloro-5-fluorophenol;2-chloro-5-fluorophenol.
What is the SMILES notation for 4-bromo-2-chloro-5-fluorophenol;2-chloro-5-fluorophenol?
The canonical SMILES for 4-bromo-2-chloro-5-fluorophenol;2-chloro-5-fluorophenol is Oc1cc(F)c(Br)cc1Cl.Oc1cc(F)ccc1Cl.
What is the InChIKey of 4-bromo-2-chloro-5-fluorophenol;2-chloro-5-fluorophenol?
The InChIKey is NFQZCTUGVTTZBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3BrClFO.C6H4ClFO/c7-3-1-4(8)6(10)2-5(3)9;7-5-2-1-4(8)3-6(5)9/h1-2,10H;1-3,9H.
What are the key properties of 4-bromo-2-chloro-5-fluorophenol;2-chloro-5-fluorophenol?
4-bromo-2-chloro-5-fluorophenol;2-chloro-5-fluorophenol has a molecular weight of 371.99 g/mol, XLogP of 5.13, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-chloro-5-fluorophenol;2-chloro-5-fluorophenol is sourced from PubChem (CID 159767315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).