C26H22BBrF6N2O2 — CID 159767713
5-bromo-2-methylpyridine;2-methyl-5-[3-(trifluoromethyl)phenyl]pyridine;[3-(trifluoromethyl)phenyl]boronic acid (PubChem CID 159767713) has the molecular formula C26H22BBrF6N2O2 and a molecular weight of 599.18 g/mol. Its IUPAC name is 5-bromo-2-methylpyridine;2-methyl-5-[3-(trifluoromethyl)phenyl]pyridine;[3-(trifluoromethyl)phenyl]boronic acid.
| Compound Name | 5-bromo-2-methylpyridine;2-methyl-5-[3-(trifluoromethyl)phenyl]pyridine;[3-(trifluoromethyl)phenyl]boronic acid |
|---|---|
| PubChem CID | 159767713 |
| Molecular Formula | C26H22BBrF6N2O2 |
| Molecular Weight | 599.18 g/mol |
| Exact Mass | 598.09 |
| IUPAC Name | 5-bromo-2-methylpyridine;2-methyl-5-[3-(trifluoromethyl)phenyl]pyridine;[3-(trifluoromethyl)phenyl]boronic acid |
| SMILES | Cc1ccc(-c2cccc(C(F)(F)F)c2)cn1.Cc1ccc(Br)cn1.OB(O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H10F3N.C7H6BF3O2.C6H6BrN/c1-9-5-6-11(8-17-9)10-3-2-4-12(7-10)13(14,15)16;9-7(10,11)5-2-1-3-6(4-5)8(12)13;1-5-2-3-6(7)4-8-5/h2-8H,1H3;1-4,12-13H;2-4H,1H3 |
| InChIKey | NFSFRRHZZPFILH-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.18 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|