About 2,2-bis(hydroxymethyl)butanal;butanal;2-(hydroxymethyl)butanal
2,2-bis(hydroxymethyl)butanal;butanal;2-(hydroxymethyl)butanal (PubChem CID 159767786) has the molecular formula C15H30O6
and a molecular weight of 306.40 g/mol. Its IUPAC name is 2,2-bis(hydroxymethyl)butanal;butanal;2-(hydroxymethyl)butanal.
Molecular Properties
| Compound Name | 2,2-bis(hydroxymethyl)butanal;butanal;2-(hydroxymethyl)butanal |
| PubChem CID | 159767786 |
| Molecular Formula | C15H30O6 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.20 |
| IUPAC Name | 2,2-bis(hydroxymethyl)butanal;butanal;2-(hydroxymethyl)butanal |
| SMILES | CCC(C=O)(CO)CO.CCC(C=O)CO.CCCC=O |
| InChI | InChI=1S/C6H12O3.C5H10O2.C4H8O/c1-2-6(3-7,4-8)5-9;1-2-5(3-6)4-7;1-2-3-4-5/h3,8-9H,2,4-5H2,1H3;3,5,7H,2,4H2,1H3;4H,2-3H2,1H3 |
| InChIKey | NFSLUKHNVGETSX-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 111.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2,2-bis(hydroxymethyl)butanal;butanal;2-(hydroxymethyl)butanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-bis(hydroxymethyl)butanal;butanal;2-(hydroxymethyl)butanal?
The IUPAC name of 2,2-bis(hydroxymethyl)butanal;butanal;2-(hydroxymethyl)butanal (CID 159767786) is 2,2-bis(hydroxymethyl)butanal;butanal;2-(hydroxymethyl)butanal.
What is the SMILES notation for 2,2-bis(hydroxymethyl)butanal;butanal;2-(hydroxymethyl)butanal?
The canonical SMILES for 2,2-bis(hydroxymethyl)butanal;butanal;2-(hydroxymethyl)butanal is CCC(C=O)(CO)CO.CCC(C=O)CO.CCCC=O.
What is the InChIKey of 2,2-bis(hydroxymethyl)butanal;butanal;2-(hydroxymethyl)butanal?
The InChIKey is NFSLUKHNVGETSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O3.C5H10O2.C4H8O/c1-2-6(3-7,4-8)5-9;1-2-5(3-6)4-7;1-2-3-4-5/h3,8-9H,2,4-5H2,1H3;3,5,7H,2,4H2,1H3;4H,2-3H2,1H3.
What are the key properties of 2,2-bis(hydroxymethyl)butanal;butanal;2-(hydroxymethyl)butanal?
2,2-bis(hydroxymethyl)butanal;butanal;2-(hydroxymethyl)butanal has a molecular weight of 306.40 g/mol, XLogP of 0.76, 9 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-bis(hydroxymethyl)butanal;butanal;2-(hydroxymethyl)butanal is sourced from PubChem (CID 159767786), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).