C25H52N4 — CID 159767975
2,6-ditert-butyl-2,6-diazaspiro[3.3]heptane;1,4-ditert-butylpiperazine (PubChem CID 159767975) has the molecular formula C25H52N4 and a molecular weight of 408.72 g/mol. Its IUPAC name is 2,6-ditert-butyl-2,6-diazaspiro[3.3]heptane;1,4-ditert-butylpiperazine.
| Compound Name | 2,6-ditert-butyl-2,6-diazaspiro[3.3]heptane;1,4-ditert-butylpiperazine |
|---|---|
| PubChem CID | 159767975 |
| Molecular Formula | C25H52N4 |
| Molecular Weight | 408.72 g/mol |
| Exact Mass | 408.42 |
| IUPAC Name | 2,6-ditert-butyl-2,6-diazaspiro[3.3]heptane;1,4-ditert-butylpiperazine |
| SMILES | CC(C)(C)N1CC2(C1)CN(C(C)(C)C)C2.CC(C)(C)N1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C13H26N2.C12H26N2/c1-11(2,3)14-7-13(8-14)9-15(10-13)12(4,5)6;1-11(2,3)13-7-9-14(10-8-13)12(4,5)6/h7-10H2,1-6H3;7-10H2,1-6H3 |
| InChIKey | NFSZNOBGILZAAN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.72 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |