C27H52FN3O2 — CID 159770051
1-(azetidin-1-yl)-3,3-dimethylbutan-1-one;1-(4,4-dimethylpent-1-en-2-yl)-3-fluoroazetidine;N,N,3,3-tetramethylbutanamide (PubChem CID 159770051) has the molecular formula C27H52FN3O2 and a molecular weight of 469.73 g/mol. Its IUPAC name is 1-(azetidin-1-yl)-3,3-dimethylbutan-1-one;1-(4,4-dimethylpent-1-en-2-yl)-3-fluoroazetidine;N,N,3,3-tetramethylbutanamide.
| Compound Name | 1-(azetidin-1-yl)-3,3-dimethylbutan-1-one;1-(4,4-dimethylpent-1-en-2-yl)-3-fluoroazetidine;N,N,3,3-tetramethylbutanamide |
|---|---|
| PubChem CID | 159770051 |
| Molecular Formula | C27H52FN3O2 |
| Molecular Weight | 469.73 g/mol |
| Exact Mass | 469.40 |
| IUPAC Name | 1-(azetidin-1-yl)-3,3-dimethylbutan-1-one;1-(4,4-dimethylpent-1-en-2-yl)-3-fluoroazetidine;N,N,3,3-tetramethylbutanamide |
| SMILES | C=C(CC(C)(C)C)N1CC(F)C1.CC(C)(C)CC(=O)N1CCC1.CN(C)C(=O)CC(C)(C)C |
| InChI | InChI=1S/C10H18FN.C9H17NO.C8H17NO/c1-8(5-10(2,3)4)12-6-9(11)7-12;1-9(2,3)7-8(11)10-5-4-6-10;1-8(2,3)6-7(10)9(4)5/h9H,1,5-7H2,2-4H3;4-7H2,1-3H3;6H2,1-5H3 |
| InChIKey | NFZPIJUTBJRXPB-UHFFFAOYSA-N |
| XLogP | 5.76 |
| TPSA | 43.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.73 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |