C17H34N2O2Y-2 — CID 159770553
4-methanidyl-2,2,6,6-tetramethylheptan-3-one;pentanehydrazide;yttrium (PubChem CID 159770553) has the molecular formula C17H34N2O2Y-2 and a molecular weight of 387.38 g/mol. Its IUPAC name is 4-methanidyl-2,2,6,6-tetramethylheptan-3-one;pentanehydrazide;yttrium.
| Compound Name | 4-methanidyl-2,2,6,6-tetramethylheptan-3-one;pentanehydrazide;yttrium |
|---|---|
| PubChem CID | 159770553 |
| Molecular Formula | C17H34N2O2Y-2 |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.17 |
| IUPAC Name | 4-methanidyl-2,2,6,6-tetramethylheptan-3-one;pentanehydrazide;yttrium |
| SMILES | [CH2-]C(CC(C)(C)C)C(=O)C(C)(C)C.[CH2-]CCCC(=O)NN.[Y] |
| InChI | InChI=1S/C12H23O.C5H11N2O.Y/c1-9(8-11(2,3)4)10(13)12(5,6)7;1-2-3-4-5(8)7-6;/h9H,1,8H2,2-7H3;1-4,6H2,(H,7,8);/q2*-1; |
| InChIKey | HHYPCNLUIDKWDL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|