About 3,4-bis(methylamino)cyclobut-3-ene-1,2-dione;phosphane;sulfanylidenephosphane
3,4-bis(methylamino)cyclobut-3-ene-1,2-dione;phosphane;sulfanylidenephosphane (PubChem CID 159771212) has the molecular formula C6H12N2O2P2S
and a molecular weight of 238.19 g/mol. Its IUPAC name is 3,4-bis(methylamino)cyclobut-3-ene-1,2-dione;phosphane;sulfanylidenephosphane.
Molecular Properties
| Compound Name | 3,4-bis(methylamino)cyclobut-3-ene-1,2-dione;phosphane;sulfanylidenephosphane |
| PubChem CID | 159771212 |
| Molecular Formula | C6H12N2O2P2S |
| Molecular Weight | 238.19 g/mol |
| Exact Mass | 238.01 |
| IUPAC Name | 3,4-bis(methylamino)cyclobut-3-ene-1,2-dione;phosphane;sulfanylidenephosphane |
| SMILES | CNc1c(NC)c(=O)c1=O.P.P=S |
| InChI | InChI=1S/C6H8N2O2.HPS.H3P/c1-7-3-4(8-2)6(10)5(3)9;1-2;/h7-8H,1-2H3;1H;1H3 |
| InChIKey | NGDDZLRBYBWAKK-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.19 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3,4-bis(methylamino)cyclobut-3-ene-1,2-dione;phosphane;sulfanylidenephosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-bis(methylamino)cyclobut-3-ene-1,2-dione;phosphane;sulfanylidenephosphane?
The IUPAC name of 3,4-bis(methylamino)cyclobut-3-ene-1,2-dione;phosphane;sulfanylidenephosphane (CID 159771212) is 3,4-bis(methylamino)cyclobut-3-ene-1,2-dione;phosphane;sulfanylidenephosphane.
What is the SMILES notation for 3,4-bis(methylamino)cyclobut-3-ene-1,2-dione;phosphane;sulfanylidenephosphane?
The canonical SMILES for 3,4-bis(methylamino)cyclobut-3-ene-1,2-dione;phosphane;sulfanylidenephosphane is CNc1c(NC)c(=O)c1=O.P.P=S.
What is the InChIKey of 3,4-bis(methylamino)cyclobut-3-ene-1,2-dione;phosphane;sulfanylidenephosphane?
The InChIKey is NGDDZLRBYBWAKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2O2.HPS.H3P/c1-7-3-4(8-2)6(10)5(3)9;1-2;/h7-8H,1-2H3;1H;1H3.
What are the key properties of 3,4-bis(methylamino)cyclobut-3-ene-1,2-dione;phosphane;sulfanylidenephosphane?
3,4-bis(methylamino)cyclobut-3-ene-1,2-dione;phosphane;sulfanylidenephosphane has a molecular weight of 238.19 g/mol, XLogP of 0.02, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-bis(methylamino)cyclobut-3-ene-1,2-dione;phosphane;sulfanylidenephosphane is sourced from PubChem (CID 159771212), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).