About benzene;bis(iodozinc(1+))
benzene;bis(iodozinc(1+)) (PubChem CID 15977188) has the molecular formula C6H4I2Zn2
and a molecular weight of 460.69 g/mol. Its IUPAC name is benzene;bis(iodozinc(1+)).
Molecular Properties
| Compound Name | benzene;bis(iodozinc(1+)) |
| PubChem CID | 15977188 |
| Molecular Formula | C6H4I2Zn2 |
| Molecular Weight | 460.69 g/mol |
| Exact Mass | 457.70 |
| IUPAC Name | benzene;bis(iodozinc(1+)) |
| SMILES | [Zn+]I.[Zn+]I.[c-]1c[c-]ccc1 |
| InChI | InChI=1S/C6H4.2HI.2Zn/c1-2-4-6-5-3-1;;;;/h1-3,6H;2*1H;;/q-2;;;2*+2/p-2 |
| InChIKey | UZOILPPGQWAABC-UHFFFAOYSA-L |
| XLogP | 3.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 460.69 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze benzene;bis(iodozinc(1+)) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;bis(iodozinc(1+))?
The IUPAC name of benzene;bis(iodozinc(1+)) (CID 15977188) is benzene;bis(iodozinc(1+)).
What is the SMILES notation for benzene;bis(iodozinc(1+))?
The canonical SMILES for benzene;bis(iodozinc(1+)) is [Zn+]I.[Zn+]I.[c-]1c[c-]ccc1.
What is the InChIKey of benzene;bis(iodozinc(1+))?
The InChIKey is UZOILPPGQWAABC-UHFFFAOYSA-L. The full InChI is InChI=1S/C6H4.2HI.2Zn/c1-2-4-6-5-3-1;;;;/h1-3,6H;2*1H;;/q-2;;;2*+2/p-2.
What are the key properties of benzene;bis(iodozinc(1+))?
benzene;bis(iodozinc(1+)) has a molecular weight of 460.69 g/mol, XLogP of 3.05, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;bis(iodozinc(1+)) is sourced from PubChem (CID 15977188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).