About (3R)-3-methyloxane;(3R)-3-methyloxolane
(3R)-3-methyloxane;(3R)-3-methyloxolane (PubChem CID 159772369) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is (3R)-3-methyloxane;(3R)-3-methyloxolane.
Molecular Properties
| Compound Name | (3R)-3-methyloxane;(3R)-3-methyloxolane |
| PubChem CID | 159772369 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | (3R)-3-methyloxane;(3R)-3-methyloxolane |
| SMILES | C[C@@H]1CCCOC1.C[C@@H]1CCOC1 |
| InChI | InChI=1S/C6H12O.C5H10O/c1-6-3-2-4-7-5-6;1-5-2-3-6-4-5/h6H,2-5H2,1H3;5H,2-4H2,1H3/t6-;5-/m11/s1 |
| InChIKey | NGGXURUUZQKJGD-KWNMGZQDSA-N |
| XLogP | 2.48 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (3R)-3-methyloxane;(3R)-3-methyloxolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-methyloxane;(3R)-3-methyloxolane?
The IUPAC name of (3R)-3-methyloxane;(3R)-3-methyloxolane (CID 159772369) is (3R)-3-methyloxane;(3R)-3-methyloxolane.
What is the SMILES notation for (3R)-3-methyloxane;(3R)-3-methyloxolane?
The canonical SMILES for (3R)-3-methyloxane;(3R)-3-methyloxolane is C[C@@H]1CCCOC1.C[C@@H]1CCOC1.
What is the InChIKey of (3R)-3-methyloxane;(3R)-3-methyloxolane?
The InChIKey is NGGXURUUZQKJGD-KWNMGZQDSA-N. The full InChI is InChI=1S/C6H12O.C5H10O/c1-6-3-2-4-7-5-6;1-5-2-3-6-4-5/h6H,2-5H2,1H3;5H,2-4H2,1H3/t6-;5-/m11/s1.
What are the key properties of (3R)-3-methyloxane;(3R)-3-methyloxolane?
(3R)-3-methyloxane;(3R)-3-methyloxolane has a molecular weight of 186.29 g/mol, XLogP of 2.48, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-methyloxane;(3R)-3-methyloxolane is sourced from PubChem (CID 159772369), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).