C30H31N6O5S2- — CID 159772696
4-(2-carboxyethyl)benzenesulfinate;4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[(3R)-piperidin-3-yl]pyrimidin-2-amine (PubChem CID 159772696) has the molecular formula C30H31N6O5S2- and a molecular weight of 619.75 g/mol. Its IUPAC name is 4-(2-carboxyethyl)benzenesulfinate;4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[(3R)-piperidin-3-yl]pyrimidin-2-amine.
| Compound Name | 4-(2-carboxyethyl)benzenesulfinate;4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[(3R)-piperidin-3-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 159772696 |
| Molecular Formula | C30H31N6O5S2- |
| Molecular Weight | 619.75 g/mol |
| Exact Mass | 619.18 |
| IUPAC Name | 4-(2-carboxyethyl)benzenesulfinate;4-[6-(3-methoxyphenyl)imidazo[2,1-b][1,3]thiazol-5-yl]-N-[(3R)-piperidin-3-yl]pyrimidin-2-amine |
| SMILES | COc1cccc(-c2nc3sccn3c2-c2ccnc(N[C@@H]3CCCNC3)n2)c1.O=C(O)CCc1ccc(S(=O)[O-])cc1 |
| InChI | InChI=1S/C21H22N6OS.C9H10O4S/c1-28-16-6-2-4-14(12-16)18-19(27-10-11-29-21(27)26-18)17-7-9-23-20(25-17)24-15-5-3-8-22-13-15;10-9(11)6-3-7-1-4-8(5-2-7)14(12)13/h2,4,6-7,9-12,15,22H,3,5,8,13H2,1H3,(H,23,24,25);1-2,4-5H,3,6H2,(H,10,11)(H,12,13)/p-1/t15-;/m1./s1 |
| InChIKey | URVFSYZHDQHUPV-XFULWGLBSA-M |
| XLogP | 4.63 |
| TPSA | 153.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.75 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|