About anthracene-9,10-dione;9H-carbazole;pyrimidine
anthracene-9,10-dione;9H-carbazole;pyrimidine (PubChem CID 159773122) has the molecular formula C30H21N3O2
and a molecular weight of 455.52 g/mol. Its IUPAC name is anthracene-9,10-dione;9H-carbazole;pyrimidine.
Molecular Properties
| Compound Name | anthracene-9,10-dione;9H-carbazole;pyrimidine |
| PubChem CID | 159773122 |
| Molecular Formula | C30H21N3O2 |
| Molecular Weight | 455.52 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | anthracene-9,10-dione;9H-carbazole;pyrimidine |
| SMILES | O=C1c2ccccc2C(=O)c2ccccc21.c1ccc2c(c1)[nH]c1ccccc12.c1cncnc1 |
| InChI | InChI=1S/C14H8O2.C12H9N.C4H4N2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-5-4-6-3-1/h1-8H;1-8,13H;1-4H |
| InChIKey | NGJLYIYPTYLABA-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 455.52 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze anthracene-9,10-dione;9H-carbazole;pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of anthracene-9,10-dione;9H-carbazole;pyrimidine?
The IUPAC name of anthracene-9,10-dione;9H-carbazole;pyrimidine (CID 159773122) is anthracene-9,10-dione;9H-carbazole;pyrimidine.
What is the SMILES notation for anthracene-9,10-dione;9H-carbazole;pyrimidine?
The canonical SMILES for anthracene-9,10-dione;9H-carbazole;pyrimidine is O=C1c2ccccc2C(=O)c2ccccc21.c1ccc2c(c1)[nH]c1ccccc12.c1cncnc1.
What is the InChIKey of anthracene-9,10-dione;9H-carbazole;pyrimidine?
The InChIKey is NGJLYIYPTYLABA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8O2.C12H9N.C4H4N2/c15-13-9-5-1-2-6-10(9)14(16)12-8-4-3-7-11(12)13;1-3-7-11-9(5-1)10-6-2-4-8-12(10)13-11;1-2-5-4-6-3-1/h1-8H;1-8,13H;1-4H.
What are the key properties of anthracene-9,10-dione;9H-carbazole;pyrimidine?
anthracene-9,10-dione;9H-carbazole;pyrimidine has a molecular weight of 455.52 g/mol, XLogP of 6.26, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for anthracene-9,10-dione;9H-carbazole;pyrimidine is sourced from PubChem (CID 159773122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).