C29H24F6O6S — CID 159773457
4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methylphenol (PubChem CID 159773457) has the molecular formula C29H24F6O6S and a molecular weight of 614.56 g/mol. Its IUPAC name is 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methylphenol.
| Compound Name | 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methylphenol |
|---|---|
| PubChem CID | 159773457 |
| Molecular Formula | C29H24F6O6S |
| Molecular Weight | 614.56 g/mol |
| Exact Mass | 614.12 |
| IUPAC Name | 4-[1,1,1,3,3,3-hexafluoro-2-(4-hydroxyphenyl)propan-2-yl]phenol;4-(4-hydroxy-3-methylphenyl)sulfonyl-2-methylphenol |
| SMILES | Cc1cc(S(=O)(=O)c2ccc(O)c(C)c2)ccc1O.Oc1ccc(C(c2ccc(O)cc2)(C(F)(F)F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C15H10F6O2.C14H14O4S/c16-14(17,18)13(15(19,20)21,9-1-5-11(22)6-2-9)10-3-7-12(23)8-4-10;1-9-7-11(3-5-13(9)15)19(17,18)12-4-6-14(16)10(2)8-12/h1-8,22-23H;3-8,15-16H,1-2H3 |
| InChIKey | NGKONWDQXVCKCG-UHFFFAOYSA-N |
| XLogP | 7.06 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.56 |
| LogP ≤ 5 | 7.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |