C9H11NO4 — CID 159773640
2-amino-4-methylcyclohexa-1,4-diene-1,3-dicarboxylic acid (PubChem CID 159773640) has the molecular formula C9H11NO4 and a molecular weight of 197.19 g/mol. Its IUPAC name is 2-amino-4-methylcyclohexa-1,4-diene-1,3-dicarboxylic acid.
| Compound Name | 2-amino-4-methylcyclohexa-1,4-diene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 159773640 |
| Molecular Formula | C9H11NO4 |
| Molecular Weight | 197.19 g/mol |
| Exact Mass | 197.07 |
| IUPAC Name | 2-amino-4-methylcyclohexa-1,4-diene-1,3-dicarboxylic acid |
| SMILES | CC1=CCC(C(=O)O)=C(N)C1C(=O)O |
| InChI | InChI=1S/C9H11NO4/c1-4-2-3-5(8(11)12)7(10)6(4)9(13)14/h2,6H,3,10H2,1H3,(H,11,12)(H,13,14) |
| InChIKey | WJNVFUHCFNHKIV-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.19 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|