C15H24O3 — CID 15977497
(1R,2R,3S,4R,5S,7R,9S)-2,6,6-trimethyl-11-methylidenetricyclo[5.4.0.02,9]undecane-3,4,5-triol (PubChem CID 15977497) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is (1R,2R,3S,4R,5S,7R,9S)-2,6,6-trimethyl-11-methylidenetricyclo[5.4.0.02,9]undecane-3,4,5-triol.
| Compound Name | (1R,2R,3S,4R,5S,7R,9S)-2,6,6-trimethyl-11-methylidenetricyclo[5.4.0.02,9]undecane-3,4,5-triol |
|---|---|
| PubChem CID | 15977497 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | (1R,2R,3S,4R,5S,7R,9S)-2,6,6-trimethyl-11-methylidenetricyclo[5.4.0.02,9]undecane-3,4,5-triol |
| SMILES | C=C1C[C@@H]2C[C@@H]3[C@H]1[C@]2(C)[C@H](O)[C@H](O)[C@@H](O)C3(C)C |
| InChI | InChI=1S/C15H24O3/c1-7-5-8-6-9-10(7)15(8,4)13(18)11(16)12(17)14(9,2)3/h8-13,16-18H,1,5-6H2,2-4H3/t8-,9-,10+,11-,12-,13-,15-/m1/s1 |
| InChIKey | DAASHTBRGSTLDB-RQDIDLLISA-N |
| XLogP | 1.33 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|