About ethanamine;imino-bis(trifluoromethyl)-λ4-sulfane
ethanamine;imino-bis(trifluoromethyl)-λ4-sulfane (PubChem CID 159775311) has the molecular formula C4H8F6N2S
and a molecular weight of 230.18 g/mol. Its IUPAC name is ethanamine;imino-bis(trifluoromethyl)-λ4-sulfane.
Molecular Properties
| Compound Name | ethanamine;imino-bis(trifluoromethyl)-λ4-sulfane |
| PubChem CID | 159775311 |
| Molecular Formula | C4H8F6N2S |
| Molecular Weight | 230.18 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | ethanamine;imino-bis(trifluoromethyl)-λ4-sulfane |
| SMILES | CCN.[H]N=S(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C2HF6NS.C2H7N/c3-1(4,5)10(9)2(6,7)8;1-2-3/h9H;2-3H2,1H3 |
| InChIKey | NGQSPSDOMCVSOX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.18 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethanamine;imino-bis(trifluoromethyl)-λ4-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethanamine;imino-bis(trifluoromethyl)-λ4-sulfane?
The IUPAC name of ethanamine;imino-bis(trifluoromethyl)-λ4-sulfane (CID 159775311) is ethanamine;imino-bis(trifluoromethyl)-λ4-sulfane.
What is the SMILES notation for ethanamine;imino-bis(trifluoromethyl)-λ4-sulfane?
The canonical SMILES for ethanamine;imino-bis(trifluoromethyl)-λ4-sulfane is CCN.[H]N=S(C(F)(F)F)C(F)(F)F.
What is the InChIKey of ethanamine;imino-bis(trifluoromethyl)-λ4-sulfane?
The InChIKey is NGQSPSDOMCVSOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C2HF6NS.C2H7N/c3-1(4,5)10(9)2(6,7)8;1-2-3/h9H;2-3H2,1H3.
What are the key properties of ethanamine;imino-bis(trifluoromethyl)-λ4-sulfane?
ethanamine;imino-bis(trifluoromethyl)-λ4-sulfane has a molecular weight of 230.18 g/mol, XLogP of 2.37, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethanamine;imino-bis(trifluoromethyl)-λ4-sulfane is sourced from PubChem (CID 159775311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).