C31H54O5 — CID 159776549
propan-2-yl 7-[(2S,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-(2-methylpropyl)-5-oxocyclopentyl]hept-5-enoate (PubChem CID 159776549) has the molecular formula C31H54O5 and a molecular weight of 506.77 g/mol. Its IUPAC name is propan-2-yl 7-[(2S,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-(2-methylpropyl)-5-oxocyclopentyl]hept-5-enoate.
| Compound Name | propan-2-yl 7-[(2S,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-(2-methylpropyl)-5-oxocyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 159776549 |
| Molecular Formula | C31H54O5 |
| Molecular Weight | 506.77 g/mol |
| Exact Mass | 506.40 |
| IUPAC Name | propan-2-yl 7-[(2S,3R)-2-[2-(2-heptyl-1,3-dioxolan-2-yl)ethyl]-3-(2-methylpropyl)-5-oxocyclopentyl]hept-5-enoate |
| SMILES | CCCCCCCC1(CC[C@@H]2C(CC=CCCCC(=O)OC(C)C)C(=O)C[C@H]2CC(C)C)OCCO1 |
| InChI | InChI=1S/C31H54O5/c1-6-7-8-11-14-18-31(34-20-21-35-31)19-17-27-26(22-24(2)3)23-29(32)28(27)15-12-9-10-13-16-30(33)36-25(4)5/h9,12,24-28H,6-8,10-11,13-23H2,1-5H3/t26-,27+,28?/m1/s1 |
| InChIKey | SHAUKJAOHGXXRV-ANUFDVCNSA-N |
| XLogP | 7.81 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.77 |
| LogP ≤ 5 | 7.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|