C26H27BrN6S2 — CID 159776564
carbononitridic bromide;N-(2,3-dihydro-1H-inden-1-yl)-4,5-dihydro-1,3-thiazol-2-amine;2-(2,3-dihydro-1H-inden-1-ylimino)-1,3-thiazolidine-3-carbonitrile (PubChem CID 159776564) has the molecular formula C26H27BrN6S2 and a molecular weight of 567.58 g/mol. Its IUPAC name is carbononitridic bromide;N-(2,3-dihydro-1H-inden-1-yl)-4,5-dihydro-1,3-thiazol-2-amine;2-(2,3-dihydro-1H-inden-1-ylimino)-1,3-thiazolidine-3-carbonitrile.
| Compound Name | carbononitridic bromide;N-(2,3-dihydro-1H-inden-1-yl)-4,5-dihydro-1,3-thiazol-2-amine;2-(2,3-dihydro-1H-inden-1-ylimino)-1,3-thiazolidine-3-carbonitrile |
|---|---|
| PubChem CID | 159776564 |
| Molecular Formula | C26H27BrN6S2 |
| Molecular Weight | 567.58 g/mol |
| Exact Mass | 566.09 |
| IUPAC Name | carbononitridic bromide;N-(2,3-dihydro-1H-inden-1-yl)-4,5-dihydro-1,3-thiazol-2-amine;2-(2,3-dihydro-1H-inden-1-ylimino)-1,3-thiazolidine-3-carbonitrile |
| SMILES | N#CBr.N#CN1CCS/C1=N\C1CCc2ccccc21.c1ccc2c(c1)CCC2NC1=NCCS1 |
| InChI | InChI=1S/C13H13N3S.C12H14N2S.CBrN/c14-9-16-7-8-17-13(16)15-12-6-5-10-3-1-2-4-11(10)12;1-2-4-10-9(3-1)5-6-11(10)14-12-13-7-8-15-12;2-1-3/h1-4,12H,5-8H2;1-4,11H,5-8H2,(H,13,14);/b15-13-;; |
| InChIKey | NGUYARKDEGWFQP-FQGJLALVSA-N |
| XLogP | 5.79 |
| TPSA | 87.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|