About ethyl 4-(propan-2-ylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylate;propan-2-amine
ethyl 4-(propan-2-ylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylate;propan-2-amine (PubChem CID 159776699) has the molecular formula C14H23F3N4O2
and a molecular weight of 336.36 g/mol. Its IUPAC name is ethyl 4-(propan-2-ylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylate;propan-2-amine.
Molecular Properties
| Compound Name | ethyl 4-(propan-2-ylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylate;propan-2-amine |
| PubChem CID | 159776699 |
| Molecular Formula | C14H23F3N4O2 |
| Molecular Weight | 336.36 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | ethyl 4-(propan-2-ylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylate;propan-2-amine |
| SMILES | CC(C)N.CCOC(=O)c1cnc(C(F)(F)F)nc1NC(C)C |
| InChI | InChI=1S/C11H14F3N3O2.C3H9N/c1-4-19-9(18)7-5-15-10(11(12,13)14)17-8(7)16-6(2)3;1-3(2)4/h5-6H,4H2,1-3H3,(H,15,16,17);3H,4H2,1-2H3 |
| InChIKey | NGVIGNYHUQOAGU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 90.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.36 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze ethyl 4-(propan-2-ylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylate;propan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(propan-2-ylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylate;propan-2-amine?
The IUPAC name of ethyl 4-(propan-2-ylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylate;propan-2-amine (CID 159776699) is ethyl 4-(propan-2-ylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylate;propan-2-amine.
What is the SMILES notation for ethyl 4-(propan-2-ylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylate;propan-2-amine?
The canonical SMILES for ethyl 4-(propan-2-ylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylate;propan-2-amine is CC(C)N.CCOC(=O)c1cnc(C(F)(F)F)nc1NC(C)C.
What is the InChIKey of ethyl 4-(propan-2-ylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylate;propan-2-amine?
The InChIKey is NGVIGNYHUQOAGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F3N3O2.C3H9N/c1-4-19-9(18)7-5-15-10(11(12,13)14)17-8(7)16-6(2)3;1-3(2)4/h5-6H,4H2,1-3H3,(H,15,16,17);3H,4H2,1-2H3.
What are the key properties of ethyl 4-(propan-2-ylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylate;propan-2-amine?
ethyl 4-(propan-2-ylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylate;propan-2-amine has a molecular weight of 336.36 g/mol, XLogP of 2.85, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(propan-2-ylamino)-2-(trifluoromethyl)pyrimidine-5-carboxylate;propan-2-amine is sourced from PubChem (CID 159776699), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).