About acetic acid;tert-butyl formate;3-ethylpiperidin-4-amine
acetic acid;tert-butyl formate;3-ethylpiperidin-4-amine (PubChem CID 159777318) has the molecular formula C14H30N2O4
and a molecular weight of 290.40 g/mol. Its IUPAC name is acetic acid;tert-butyl formate;3-ethylpiperidin-4-amine.
Molecular Properties
| Compound Name | acetic acid;tert-butyl formate;3-ethylpiperidin-4-amine |
| PubChem CID | 159777318 |
| Molecular Formula | C14H30N2O4 |
| Molecular Weight | 290.40 g/mol |
| Exact Mass | 290.22 |
| IUPAC Name | acetic acid;tert-butyl formate;3-ethylpiperidin-4-amine |
| SMILES | CC(=O)O.CC(C)(C)OC=O.CCC1CNCCC1N |
| InChI | InChI=1S/C7H16N2.C5H10O2.C2H4O2/c1-2-6-5-9-4-3-7(6)8;1-5(2,3)7-4-6;1-2(3)4/h6-7,9H,2-5,8H2,1H3;4H,1-3H3;1H3,(H,3,4) |
| InChIKey | UZQNSUPOJGBFSJ-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.40 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;tert-butyl formate;3-ethylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;tert-butyl formate;3-ethylpiperidin-4-amine?
The IUPAC name of acetic acid;tert-butyl formate;3-ethylpiperidin-4-amine (CID 159777318) is acetic acid;tert-butyl formate;3-ethylpiperidin-4-amine.
What is the SMILES notation for acetic acid;tert-butyl formate;3-ethylpiperidin-4-amine?
The canonical SMILES for acetic acid;tert-butyl formate;3-ethylpiperidin-4-amine is CC(=O)O.CC(C)(C)OC=O.CCC1CNCCC1N.
What is the InChIKey of acetic acid;tert-butyl formate;3-ethylpiperidin-4-amine?
The InChIKey is UZQNSUPOJGBFSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16N2.C5H10O2.C2H4O2/c1-2-6-5-9-4-3-7(6)8;1-5(2,3)7-4-6;1-2(3)4/h6-7,9H,2-5,8H2,1H3;4H,1-3H3;1H3,(H,3,4).
What are the key properties of acetic acid;tert-butyl formate;3-ethylpiperidin-4-amine?
acetic acid;tert-butyl formate;3-ethylpiperidin-4-amine has a molecular weight of 290.40 g/mol, XLogP of 1.38, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;tert-butyl formate;3-ethylpiperidin-4-amine is sourced from PubChem (CID 159777318), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).