C3HBr9 — CID 159778348
1,1,1,2,2-pentabromoethane;tetrabromomethane (PubChem CID 159778348) has the molecular formula C3HBr9 and a molecular weight of 756.18 g/mol. Its IUPAC name is 1,1,1,2,2-pentabromoethane;tetrabromomethane.
| Compound Name | 1,1,1,2,2-pentabromoethane;tetrabromomethane |
|---|---|
| PubChem CID | 159778348 |
| Molecular Formula | C3HBr9 |
| Molecular Weight | 756.18 g/mol |
| Exact Mass | 747.27 |
| IUPAC Name | 1,1,1,2,2-pentabromoethane;tetrabromomethane |
| SMILES | BrC(Br)(Br)Br.BrC(Br)C(Br)(Br)Br |
| InChI | InChI=1S/C2HBr5.CBr4/c3-1(4)2(5,6)7;2-1(3,4)5/h1H; |
| InChIKey | NHANUUKRIQVLQW-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.18 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|