About 6-(chloromethyl)-N,N-dimethylpyridine-2-carboxamide;methanesulfonyl chloride
6-(chloromethyl)-N,N-dimethylpyridine-2-carboxamide;methanesulfonyl chloride (PubChem CID 159778955) has the molecular formula C10H14Cl2N2O3S
and a molecular weight of 313.21 g/mol. Its IUPAC name is 6-(chloromethyl)-N,N-dimethylpyridine-2-carboxamide;methanesulfonyl chloride.
Molecular Properties
| Compound Name | 6-(chloromethyl)-N,N-dimethylpyridine-2-carboxamide;methanesulfonyl chloride |
| PubChem CID | 159778955 |
| Molecular Formula | C10H14Cl2N2O3S |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.01 |
| IUPAC Name | 6-(chloromethyl)-N,N-dimethylpyridine-2-carboxamide;methanesulfonyl chloride |
| SMILES | CN(C)C(=O)c1cccc(CCl)n1.CS(=O)(=O)Cl |
| InChI | InChI=1S/C9H11ClN2O.CH3ClO2S/c1-12(2)9(13)8-5-3-4-7(6-10)11-8;1-5(2,3)4/h3-5H,6H2,1-2H3;1H3 |
| InChIKey | NHCNTLJJTRVNML-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-(chloromethyl)-N,N-dimethylpyridine-2-carboxamide;methanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(chloromethyl)-N,N-dimethylpyridine-2-carboxamide;methanesulfonyl chloride?
The IUPAC name of 6-(chloromethyl)-N,N-dimethylpyridine-2-carboxamide;methanesulfonyl chloride (CID 159778955) is 6-(chloromethyl)-N,N-dimethylpyridine-2-carboxamide;methanesulfonyl chloride.
What is the SMILES notation for 6-(chloromethyl)-N,N-dimethylpyridine-2-carboxamide;methanesulfonyl chloride?
The canonical SMILES for 6-(chloromethyl)-N,N-dimethylpyridine-2-carboxamide;methanesulfonyl chloride is CN(C)C(=O)c1cccc(CCl)n1.CS(=O)(=O)Cl.
What is the InChIKey of 6-(chloromethyl)-N,N-dimethylpyridine-2-carboxamide;methanesulfonyl chloride?
The InChIKey is NHCNTLJJTRVNML-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11ClN2O.CH3ClO2S/c1-12(2)9(13)8-5-3-4-7(6-10)11-8;1-5(2,3)4/h3-5H,6H2,1-2H3;1H3.
What are the key properties of 6-(chloromethyl)-N,N-dimethylpyridine-2-carboxamide;methanesulfonyl chloride?
6-(chloromethyl)-N,N-dimethylpyridine-2-carboxamide;methanesulfonyl chloride has a molecular weight of 313.21 g/mol, XLogP of 1.71, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(chloromethyl)-N,N-dimethylpyridine-2-carboxamide;methanesulfonyl chloride is sourced from PubChem (CID 159778955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).