C12H22O4Pr2 — CID 159779227
praseodymium;(5R,6S)-1,1,5-trihydroxy-2,2,6-trimethylnon-8-en-3-one (PubChem CID 159779227) has the molecular formula C12H22O4Pr2 and a molecular weight of 512.12 g/mol. Its IUPAC name is praseodymium;(5R,6S)-1,1,5-trihydroxy-2,2,6-trimethylnon-8-en-3-one.
| Compound Name | praseodymium;(5R,6S)-1,1,5-trihydroxy-2,2,6-trimethylnon-8-en-3-one |
|---|---|
| PubChem CID | 159779227 |
| Molecular Formula | C12H22O4Pr2 |
| Molecular Weight | 512.12 g/mol |
| Exact Mass | 511.97 |
| IUPAC Name | praseodymium;(5R,6S)-1,1,5-trihydroxy-2,2,6-trimethylnon-8-en-3-one |
| SMILES | C=CC[C@H](C)[C@H](O)CC(=O)C(C)(C)C(O)O.[Pr].[Pr] |
| InChI | InChI=1S/C12H22O4.2Pr/c1-5-6-8(2)9(13)7-10(14)12(3,4)11(15)16;;/h5,8-9,11,13,15-16H,1,6-7H2,2-4H3;;/t8-,9+;;/m0../s1 |
| InChIKey | NHDKBWGUFAUSDV-DBEJOZALSA-N |
| XLogP | 0.86 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.12 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|