About methyl 3-[2-[(2,4-difluorophenyl)methyl]-1,3-oxazol-5-yl]benzoate
methyl 3-[2-[(2,4-difluorophenyl)methyl]-1,3-oxazol-5-yl]benzoate (PubChem CID 159781603) has the molecular formula C18H13F2NO3
and a molecular weight of 329.30 g/mol. Its IUPAC name is methyl 3-[2-[(2,4-difluorophenyl)methyl]-1,3-oxazol-5-yl]benzoate.
Molecular Properties
| Compound Name | methyl 3-[2-[(2,4-difluorophenyl)methyl]-1,3-oxazol-5-yl]benzoate |
| PubChem CID | 159781603 |
| Molecular Formula | C18H13F2NO3 |
| Molecular Weight | 329.30 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | methyl 3-[2-[(2,4-difluorophenyl)methyl]-1,3-oxazol-5-yl]benzoate |
| SMILES | COC(=O)c1cccc(-c2cnc(Cc3ccc(F)cc3F)o2)c1 |
| InChI | InChI=1S/C18H13F2NO3/c1-23-18(22)13-4-2-3-12(7-13)16-10-21-17(24-16)8-11-5-6-14(19)9-15(11)20/h2-7,9-10H,8H2,1H3 |
| InChIKey | NHKSXCOIFHDPHG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.30 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 3-[2-[(2,4-difluorophenyl)methyl]-1,3-oxazol-5-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-[2-[(2,4-difluorophenyl)methyl]-1,3-oxazol-5-yl]benzoate?
The IUPAC name of methyl 3-[2-[(2,4-difluorophenyl)methyl]-1,3-oxazol-5-yl]benzoate (CID 159781603) is methyl 3-[2-[(2,4-difluorophenyl)methyl]-1,3-oxazol-5-yl]benzoate.
What is the SMILES notation for methyl 3-[2-[(2,4-difluorophenyl)methyl]-1,3-oxazol-5-yl]benzoate?
The canonical SMILES for methyl 3-[2-[(2,4-difluorophenyl)methyl]-1,3-oxazol-5-yl]benzoate is COC(=O)c1cccc(-c2cnc(Cc3ccc(F)cc3F)o2)c1.
What is the InChIKey of methyl 3-[2-[(2,4-difluorophenyl)methyl]-1,3-oxazol-5-yl]benzoate?
The InChIKey is NHKSXCOIFHDPHG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H13F2NO3/c1-23-18(22)13-4-2-3-12(7-13)16-10-21-17(24-16)8-11-5-6-14(19)9-15(11)20/h2-7,9-10H,8H2,1H3.
What are the key properties of methyl 3-[2-[(2,4-difluorophenyl)methyl]-1,3-oxazol-5-yl]benzoate?
methyl 3-[2-[(2,4-difluorophenyl)methyl]-1,3-oxazol-5-yl]benzoate has a molecular weight of 329.30 g/mol, XLogP of 4.00, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-[2-[(2,4-difluorophenyl)methyl]-1,3-oxazol-5-yl]benzoate is sourced from PubChem (CID 159781603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).