C20H47N3O6Si3 — CID 159781968
3-[1,9-bis(3-aminopropyl)-5,7-dimethyl-3-propan-2-yl-9-propan-2-yloxy-2,4,8,10,11-pentaoxa-1,3,9-trisilabicyclo[4.4.1]undecan-3-yl]propan-1-amine (PubChem CID 159781968) has the molecular formula C20H47N3O6Si3 and a molecular weight of 509.87 g/mol. Its IUPAC name is 3-[1,9-bis(3-aminopropyl)-5,7-dimethyl-3-propan-2-yl-9-propan-2-yloxy-2,4,8,10,11-pentaoxa-1,3,9-trisilabicyclo[4.4.1]undecan-3-yl]propan-1-amine.
| Compound Name | 3-[1,9-bis(3-aminopropyl)-5,7-dimethyl-3-propan-2-yl-9-propan-2-yloxy-2,4,8,10,11-pentaoxa-1,3,9-trisilabicyclo[4.4.1]undecan-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 159781968 |
| Molecular Formula | C20H47N3O6Si3 |
| Molecular Weight | 509.87 g/mol |
| Exact Mass | 509.28 |
| IUPAC Name | 3-[1,9-bis(3-aminopropyl)-5,7-dimethyl-3-propan-2-yl-9-propan-2-yloxy-2,4,8,10,11-pentaoxa-1,3,9-trisilabicyclo[4.4.1]undecan-3-yl]propan-1-amine |
| SMILES | CC(C)O[Si]1(CCCN)OC(C)C2O[Si](CCCN)(O1)O[Si](CCCN)(C(C)C)OC2C |
| InChI | InChI=1S/C20H47N3O6Si3/c1-16(2)24-31(14-8-11-22)26-19(6)20-18(5)25-30(17(3)4,13-7-10-21)28-32(27-20,29-31)15-9-12-23/h16-20H,7-15,21-23H2,1-6H3 |
| InChIKey | GSKXYWNHMUOUBH-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 133.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.87 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|