About 4-methyl-4-oxidomorpholin-4-ium;morpholine
4-methyl-4-oxidomorpholin-4-ium;morpholine (PubChem CID 159781986) has the molecular formula C9H20N2O3
and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-methyl-4-oxidomorpholin-4-ium;morpholine.
Molecular Properties
| Compound Name | 4-methyl-4-oxidomorpholin-4-ium;morpholine |
| PubChem CID | 159781986 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 4-methyl-4-oxidomorpholin-4-ium;morpholine |
| SMILES | C1COCCN1.C[N+]1([O-])CCOCC1 |
| InChI | InChI=1S/C5H11NO2.C4H9NO/c1-6(7)2-4-8-5-3-6;1-3-6-4-2-5-1/h2-5H2,1H3;5H,1-4H2 |
| InChIKey | NHLYGPJDMWRKIB-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 53.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-4-oxidomorpholin-4-ium;morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-4-oxidomorpholin-4-ium;morpholine?
The IUPAC name of 4-methyl-4-oxidomorpholin-4-ium;morpholine (CID 159781986) is 4-methyl-4-oxidomorpholin-4-ium;morpholine.
What is the SMILES notation for 4-methyl-4-oxidomorpholin-4-ium;morpholine?
The canonical SMILES for 4-methyl-4-oxidomorpholin-4-ium;morpholine is C1COCCN1.C[N+]1([O-])CCOCC1.
What is the InChIKey of 4-methyl-4-oxidomorpholin-4-ium;morpholine?
The InChIKey is NHLYGPJDMWRKIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO2.C4H9NO/c1-6(7)2-4-8-5-3-6;1-3-6-4-2-5-1/h2-5H2,1H3;5H,1-4H2.
What are the key properties of 4-methyl-4-oxidomorpholin-4-ium;morpholine?
4-methyl-4-oxidomorpholin-4-ium;morpholine has a molecular weight of 204.27 g/mol, XLogP of -0.43, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-4-oxidomorpholin-4-ium;morpholine is sourced from PubChem (CID 159781986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).