C44H34N4O — CID 159783397
3-[3-[diphenyl-[9-[4-(trideuteriomethyl)-2-pyridinyl]carbazol-2-yl]methyl]phenyl]-1-methyl-2,1,3-benzoxadiazole (PubChem CID 159783397) has the molecular formula C44H34N4O and a molecular weight of 637.80 g/mol. Its IUPAC name is 3-[3-[diphenyl-[9-[4-(trideuteriomethyl)-2-pyridinyl]carbazol-2-yl]methyl]phenyl]-1-methyl-2,1,3-benzoxadiazole.
| Compound Name | 3-[3-[diphenyl-[9-[4-(trideuteriomethyl)-2-pyridinyl]carbazol-2-yl]methyl]phenyl]-1-methyl-2,1,3-benzoxadiazole |
|---|---|
| PubChem CID | 159783397 |
| Molecular Formula | C44H34N4O |
| Molecular Weight | 637.80 g/mol |
| Exact Mass | 637.29 |
| IUPAC Name | 3-[3-[diphenyl-[9-[4-(trideuteriomethyl)-2-pyridinyl]carbazol-2-yl]methyl]phenyl]-1-methyl-2,1,3-benzoxadiazole |
| SMILES | [2H]C([2H])([2H])c1ccnc(-n2c3ccccc3c3ccc(C(c4ccccc4)(c4ccccc4)c4cccc(N5ON(C)c6ccccc65)c4)cc32)c1 |
| InChI | InChI=1S/C44H34N4O/c1-31-26-27-45-43(28-31)47-39-21-10-9-20-37(39)38-25-24-35(30-42(38)47)44(32-14-5-3-6-15-32,33-16-7-4-8-17-33)34-18-13-19-36(29-34)48-41-23-12-11-22-40(41)46(2)49-48/h3-30H,1-2H3/i1D3 |
| InChIKey | QZZMVZVCWAMMAA-FIBGUPNXSA-N |
| XLogP | 10.30 |
| TPSA | 33.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.80 |
| LogP ≤ 5 | 10.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|