C17H29NO — CID 159783598
2,2,6,6-tetramethylpiperidin-4-ol;1,4-xylene (PubChem CID 159783598) has the molecular formula C17H29NO and a molecular weight of 263.43 g/mol. Its IUPAC name is 2,2,6,6-tetramethylpiperidin-4-ol;1,4-xylene.
| Compound Name | 2,2,6,6-tetramethylpiperidin-4-ol;1,4-xylene |
|---|---|
| PubChem CID | 159783598 |
| Molecular Formula | C17H29NO |
| Molecular Weight | 263.43 g/mol |
| Exact Mass | 263.22 |
| IUPAC Name | 2,2,6,6-tetramethylpiperidin-4-ol;1,4-xylene |
| SMILES | CC1(C)CC(O)CC(C)(C)N1.Cc1ccc(C)cc1 |
| InChI | InChI=1S/C9H19NO.C8H10/c1-8(2)5-7(11)6-9(3,4)10-8;1-7-3-5-8(2)6-4-7/h7,10-11H,5-6H2,1-4H3;3-6H,1-2H3 |
| InChIKey | MWROAJPWRUWCML-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |