C25H48N4O5 — CID 159786200
tert-butyl N-[1-(oxan-4-yl)piperidin-4-yl]carbamate;tert-butyl N-piperidin-4-ylcarbamate (PubChem CID 159786200) has the molecular formula C25H48N4O5 and a molecular weight of 484.68 g/mol. Its IUPAC name is tert-butyl N-[1-(oxan-4-yl)piperidin-4-yl]carbamate;tert-butyl N-piperidin-4-ylcarbamate.
| Compound Name | tert-butyl N-[1-(oxan-4-yl)piperidin-4-yl]carbamate;tert-butyl N-piperidin-4-ylcarbamate |
|---|---|
| PubChem CID | 159786200 |
| Molecular Formula | C25H48N4O5 |
| Molecular Weight | 484.68 g/mol |
| Exact Mass | 484.36 |
| IUPAC Name | tert-butyl N-[1-(oxan-4-yl)piperidin-4-yl]carbamate;tert-butyl N-piperidin-4-ylcarbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C2CCOCC2)CC1.CC(C)(C)OC(=O)NC1CCNCC1 |
| InChI | InChI=1S/C15H28N2O3.C10H20N2O2/c1-15(2,3)20-14(18)16-12-4-8-17(9-5-12)13-6-10-19-11-7-13;1-10(2,3)14-9(13)12-8-4-6-11-7-5-8/h12-13H,4-11H2,1-3H3,(H,16,18);8,11H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | NHZBGEOOCYZPRJ-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 101.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.68 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |