C11H19IN2 — CID 159787015
(3aS,7aS)-1-(cyclopropylmethyl)-6-iodo-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine (PubChem CID 159787015) has the molecular formula C11H19IN2 and a molecular weight of 306.19 g/mol. Its IUPAC name is (3aS,7aS)-1-(cyclopropylmethyl)-6-iodo-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine.
| Compound Name | (3aS,7aS)-1-(cyclopropylmethyl)-6-iodo-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 159787015 |
| Molecular Formula | C11H19IN2 |
| Molecular Weight | 306.19 g/mol |
| Exact Mass | 306.06 |
| IUPAC Name | (3aS,7aS)-1-(cyclopropylmethyl)-6-iodo-3,3a,4,5,7,7a-hexahydro-2H-pyrrolo[2,3-c]pyridine |
| SMILES | IN1CC[C@@H]2CCN(CC3CC3)[C@@H]2C1 |
| InChI | InChI=1S/C11H19IN2/c12-14-6-4-10-3-5-13(11(10)8-14)7-9-1-2-9/h9-11H,1-8H2/t10-,11+/m0/s1 |
| InChIKey | NIBQPBUQUWVIPQ-WDEREUQCSA-N |
| XLogP | 2.14 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.19 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|