C28H42O8 — CID 15978737
(1R,2S,5R,9R,10R,11E,13S,14S,15S,16S,17R)-1,16-dihydroxy-9,10,17-trimethoxy-2,13,15-trimethyl-5-phenyl-4,18-dioxabicyclo[12.3.1]octadec-11-en-3-one (PubChem CID 15978737) has the molecular formula C28H42O8 and a molecular weight of 506.64 g/mol. Its IUPAC name is (1R,2S,5R,9R,10R,11E,13S,14S,15S,16S,17R)-1,16-dihydroxy-9,10,17-trimethoxy-2,13,15-trimethyl-5-phenyl-4,18-dioxabicyclo[12.3.1]octadec-11-en-3-one.
| Compound Name | (1R,2S,5R,9R,10R,11E,13S,14S,15S,16S,17R)-1,16-dihydroxy-9,10,17-trimethoxy-2,13,15-trimethyl-5-phenyl-4,18-dioxabicyclo[12.3.1]octadec-11-en-3-one |
|---|---|
| PubChem CID | 15978737 |
| Molecular Formula | C28H42O8 |
| Molecular Weight | 506.64 g/mol |
| Exact Mass | 506.29 |
| IUPAC Name | (1R,2S,5R,9R,10R,11E,13S,14S,15S,16S,17R)-1,16-dihydroxy-9,10,17-trimethoxy-2,13,15-trimethyl-5-phenyl-4,18-dioxabicyclo[12.3.1]octadec-11-en-3-one |
| SMILES | CO[C@@H]1[C@@H](O)[C@H](C)[C@H]2O[C@]1(O)[C@H](C)C(=O)O[C@@H](c1ccccc1)CCC[C@@H](OC)[C@H](OC)/C=C\[C@@H]2C |
| InChI | InChI=1S/C28H42O8/c1-17-15-16-23(33-5)22(32-4)14-10-13-21(20-11-8-7-9-12-20)35-27(30)19(3)28(31)26(34-6)24(29)18(2)25(17)36-28/h7-9,11-12,15-19,21-26,29,31H,10,13-14H2,1-6H3/b16-15-/t17-,18-,19+,21+,22+,23+,24-,25-,26+,28+/m0/s1 |
| InChIKey | ZGPRZYFZXBKXKL-PLOAOJSPSA-N |
| XLogP | 3.41 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.64 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|