About ethenyl acetate;2-methylpropoxysilane
ethenyl acetate;2-methylpropoxysilane (PubChem CID 159787545) has the molecular formula C8H18O3Si
and a molecular weight of 190.31 g/mol. Its IUPAC name is ethenyl acetate;2-methylpropoxysilane.
Molecular Properties
| Compound Name | ethenyl acetate;2-methylpropoxysilane |
| PubChem CID | 159787545 |
| Molecular Formula | C8H18O3Si |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | ethenyl acetate;2-methylpropoxysilane |
| SMILES | C=COC(C)=O.CC(C)CO[SiH3] |
| InChI | InChI=1S/C4H6O2.C4H12OSi/c1-3-6-4(2)5;1-4(2)3-5-6/h3H,1H2,2H3;4H,3H2,1-2,6H3 |
| InChIKey | NIDIBADYGFUHMX-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethenyl acetate;2-methylpropoxysilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl acetate;2-methylpropoxysilane?
The IUPAC name of ethenyl acetate;2-methylpropoxysilane (CID 159787545) is ethenyl acetate;2-methylpropoxysilane.
What is the SMILES notation for ethenyl acetate;2-methylpropoxysilane?
The canonical SMILES for ethenyl acetate;2-methylpropoxysilane is C=COC(C)=O.CC(C)CO[SiH3].
What is the InChIKey of ethenyl acetate;2-methylpropoxysilane?
The InChIKey is NIDIBADYGFUHMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O2.C4H12OSi/c1-3-6-4(2)5;1-4(2)3-5-6/h3H,1H2,2H3;4H,3H2,1-2,6H3.
What are the key properties of ethenyl acetate;2-methylpropoxysilane?
ethenyl acetate;2-methylpropoxysilane has a molecular weight of 190.31 g/mol, XLogP of 0.63, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl acetate;2-methylpropoxysilane is sourced from PubChem (CID 159787545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).