C21H26Cl4N4O5S2 — CID 159787669
4-amino-N,N-bis(2-chloroethyl)benzenesulfonamide;N,N-bis(2-chloroethyl)-4-isocyanatobenzenesulfonamide (PubChem CID 159787669) has the molecular formula C21H26Cl4N4O5S2 and a molecular weight of 620.41 g/mol. Its IUPAC name is 4-amino-N,N-bis(2-chloroethyl)benzenesulfonamide;N,N-bis(2-chloroethyl)-4-isocyanatobenzenesulfonamide.
| Compound Name | 4-amino-N,N-bis(2-chloroethyl)benzenesulfonamide;N,N-bis(2-chloroethyl)-4-isocyanatobenzenesulfonamide |
|---|---|
| PubChem CID | 159787669 |
| Molecular Formula | C21H26Cl4N4O5S2 |
| Molecular Weight | 620.41 g/mol |
| Exact Mass | 618.01 |
| IUPAC Name | 4-amino-N,N-bis(2-chloroethyl)benzenesulfonamide;N,N-bis(2-chloroethyl)-4-isocyanatobenzenesulfonamide |
| SMILES | Nc1ccc(S(=O)(=O)N(CCCl)CCCl)cc1.O=C=Nc1ccc(S(=O)(=O)N(CCCl)CCCl)cc1 |
| InChI | InChI=1S/C11H12Cl2N2O3S.C10H14Cl2N2O2S/c12-5-7-15(8-6-13)19(17,18)11-3-1-10(2-4-11)14-9-16;11-5-7-14(8-6-12)17(15,16)10-3-1-9(13)2-4-10/h1-4H,5-8H2;1-4H,5-8,13H2 |
| InChIKey | NIDTVJFKJNBUPI-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 130.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|