C17H15Br3N4O8 — CID 159788400
carbon dioxide;2,3-dibromo-5-nitropyridine;ethyl 2-(3-bromo-5-nitro-2-pyridinyl)butanoate (PubChem CID 159788400) has the molecular formula C17H15Br3N4O8 and a molecular weight of 643.04 g/mol. Its IUPAC name is carbon dioxide;2,3-dibromo-5-nitropyridine;ethyl 2-(3-bromo-5-nitro-2-pyridinyl)butanoate.
| Compound Name | carbon dioxide;2,3-dibromo-5-nitropyridine;ethyl 2-(3-bromo-5-nitro-2-pyridinyl)butanoate |
|---|---|
| PubChem CID | 159788400 |
| Molecular Formula | C17H15Br3N4O8 |
| Molecular Weight | 643.04 g/mol |
| Exact Mass | 639.84 |
| IUPAC Name | carbon dioxide;2,3-dibromo-5-nitropyridine;ethyl 2-(3-bromo-5-nitro-2-pyridinyl)butanoate |
| SMILES | CCOC(=O)C(CC)c1ncc([N+](=O)[O-])cc1Br.O=C=O.O=[N+]([O-])c1cnc(Br)c(Br)c1 |
| InChI | InChI=1S/C11H13BrN2O4.C5H2Br2N2O2.CO2/c1-3-8(11(15)18-4-2)10-9(12)5-7(6-13-10)14(16)17;6-4-1-3(9(10)11)2-8-5(4)7;2-1-3/h5-6,8H,3-4H2,1-2H3;1-2H; |
| InChIKey | NIGCBEHCFFRVHG-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 172.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.04 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|