About [4-[2-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]-4-pyridinyl]morpholin-2-yl]methanol
[4-[2-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]-4-pyridinyl]morpholin-2-yl]methanol (PubChem CID 15978890) has the molecular formula C18H19N5O2S
and a molecular weight of 369.45 g/mol. Its IUPAC name is [4-[2-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]-4-pyridinyl]morpholin-2-yl]methanol.
Molecular Properties
| Compound Name | [4-[2-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]-4-pyridinyl]morpholin-2-yl]methanol |
| PubChem CID | 15978890 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | [4-[2-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]-4-pyridinyl]morpholin-2-yl]methanol |
| SMILES | OCC1CN(c2ccnc(Nc3ncc(-c4cccnc4)s3)c2)CCO1 |
| InChI | InChI=1S/C18H19N5O2S/c24-12-15-11-23(6-7-25-15)14-3-5-20-17(8-14)22-18-21-10-16(26-18)13-2-1-4-19-9-13/h1-5,8-10,15,24H,6-7,11-12H2,(H,20,21,22) |
| InChIKey | JROIOLKNLAZRTG-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze [4-[2-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]-4-pyridinyl]morpholin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[2-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]-4-pyridinyl]morpholin-2-yl]methanol?
The IUPAC name of [4-[2-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]-4-pyridinyl]morpholin-2-yl]methanol (CID 15978890) is [4-[2-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]-4-pyridinyl]morpholin-2-yl]methanol.
What is the SMILES notation for [4-[2-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]-4-pyridinyl]morpholin-2-yl]methanol?
The canonical SMILES for [4-[2-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]-4-pyridinyl]morpholin-2-yl]methanol is OCC1CN(c2ccnc(Nc3ncc(-c4cccnc4)s3)c2)CCO1.
What is the InChIKey of [4-[2-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]-4-pyridinyl]morpholin-2-yl]methanol?
The InChIKey is JROIOLKNLAZRTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19N5O2S/c24-12-15-11-23(6-7-25-15)14-3-5-20-17(8-14)22-18-21-10-16(26-18)13-2-1-4-19-9-13/h1-5,8-10,15,24H,6-7,11-12H2,(H,20,21,22).
What are the key properties of [4-[2-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]-4-pyridinyl]morpholin-2-yl]methanol?
[4-[2-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]-4-pyridinyl]morpholin-2-yl]methanol has a molecular weight of 369.45 g/mol, XLogP of 2.54, 5 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[2-[(5-pyridin-3-yl-1,3-thiazol-2-yl)amino]-4-pyridinyl]morpholin-2-yl]methanol is sourced from PubChem (CID 15978890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).