C21H22FN3O2 — CID 15978985
ethyl 5-fluoro-1-[(2-pyrrolidin-2-yl-3-pyridinyl)methyl]indole-2-carboxylate (PubChem CID 15978985) has the molecular formula C21H22FN3O2 and a molecular weight of 367.42 g/mol. Its IUPAC name is ethyl 5-fluoro-1-[(2-pyrrolidin-2-yl-3-pyridinyl)methyl]indole-2-carboxylate.
| Compound Name | ethyl 5-fluoro-1-[(2-pyrrolidin-2-yl-3-pyridinyl)methyl]indole-2-carboxylate |
|---|---|
| PubChem CID | 15978985 |
| Molecular Formula | C21H22FN3O2 |
| Molecular Weight | 367.42 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | ethyl 5-fluoro-1-[(2-pyrrolidin-2-yl-3-pyridinyl)methyl]indole-2-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(F)ccc2n1Cc1cccnc1C1CCCN1 |
| InChI | InChI=1S/C21H22FN3O2/c1-2-27-21(26)19-12-15-11-16(22)7-8-18(15)25(19)13-14-5-3-10-24-20(14)17-6-4-9-23-17/h3,5,7-8,10-12,17,23H,2,4,6,9,13H2,1H3 |
| InChIKey | LHTJCOPRRFJICF-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |