C62H69BN7O11P — CID 159789987
CID 159789987 (PubChem CID 159789987) has the molecular formula C62H69BN7O11P and a molecular weight of 1131.06 g/mol.
| Compound Name | CID 159789987 |
|---|---|
| PubChem CID | 159789987 |
| Molecular Formula | C62H69BN7O11P |
| Molecular Weight | 1131.06 g/mol |
| Exact Mass | 1130.49 |
| IUPAC Name | — |
| SMILES | COc1ccc(C2=CN3C(=O)c4cc(C)c(OCCCOc5cc6c(cc5OC)C(=O)N5C=C(c7ccc(NC(=O)[C@H](C)CC(=O)[C@@H](NC(=O)CCCCCN8C(=O)C=CC8=O)C(C)C)cc7)C[C@H]5C=N6)cc4N=C[C@]3(C)C2)cc1.[2H]P[B] |
| InChI | InChI=1S/C62H67N7O11.BH2P/c1-37(2)58(66-55(71)12-9-8-10-23-67-56(72)21-22-57(67)73)51(70)27-39(4)59(74)65-44-17-13-40(14-18-44)42-28-45-33-63-49-31-54(53(78-7)29-48(49)60(75)68(45)34-42)80-25-11-24-79-52-30-50-47(26-38(52)3)61(76)69-35-43(32-62(69,5)36-64-50)41-15-19-46(77-6)20-16-41;1-2/h13-22,26,29-31,33-37,39,45,58H,8-12,23-25,27-28,32H2,1-7H3,(H,65,74)(H,66,71);2H2/t39-,45+,58+,62+;/m1./s1/i;2D |
| InChIKey | OHFLWVMTHMXGGN-NHZQUNJHSA-N |
| XLogP | 9.30 |
| TPSA | 214.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1131.06 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|