About (4S,5R)-5-ethyl-3,3-difluoro-4-methylthiolan-2-ol
(4S,5R)-5-ethyl-3,3-difluoro-4-methylthiolan-2-ol (PubChem CID 159789997) has the molecular formula C7H12F2OS
and a molecular weight of 182.23 g/mol. Its IUPAC name is (4S,5R)-5-ethyl-3,3-difluoro-4-methylthiolan-2-ol.
Molecular Properties
| Compound Name | (4S,5R)-5-ethyl-3,3-difluoro-4-methylthiolan-2-ol |
| PubChem CID | 159789997 |
| Molecular Formula | C7H12F2OS |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.06 |
| IUPAC Name | (4S,5R)-5-ethyl-3,3-difluoro-4-methylthiolan-2-ol |
| SMILES | CC[C@H]1SC(O)C(F)(F)[C@@H]1C |
| InChI | InChI=1S/C7H12F2OS/c1-3-5-4(2)7(8,9)6(10)11-5/h4-6,10H,3H2,1-2H3/t4-,5-,6?/m1/s1 |
| InChIKey | LFXNAYQHLKTXMT-QYRBDRAASA-N |
| XLogP | 2.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4S,5R)-5-ethyl-3,3-difluoro-4-methylthiolan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S,5R)-5-ethyl-3,3-difluoro-4-methylthiolan-2-ol?
The IUPAC name of (4S,5R)-5-ethyl-3,3-difluoro-4-methylthiolan-2-ol (CID 159789997) is (4S,5R)-5-ethyl-3,3-difluoro-4-methylthiolan-2-ol.
What is the SMILES notation for (4S,5R)-5-ethyl-3,3-difluoro-4-methylthiolan-2-ol?
The canonical SMILES for (4S,5R)-5-ethyl-3,3-difluoro-4-methylthiolan-2-ol is CC[C@H]1SC(O)C(F)(F)[C@@H]1C.
What is the InChIKey of (4S,5R)-5-ethyl-3,3-difluoro-4-methylthiolan-2-ol?
The InChIKey is LFXNAYQHLKTXMT-QYRBDRAASA-N. The full InChI is InChI=1S/C7H12F2OS/c1-3-5-4(2)7(8,9)6(10)11-5/h4-6,10H,3H2,1-2H3/t4-,5-,6?/m1/s1.
What are the key properties of (4S,5R)-5-ethyl-3,3-difluoro-4-methylthiolan-2-ol?
(4S,5R)-5-ethyl-3,3-difluoro-4-methylthiolan-2-ol has a molecular weight of 182.23 g/mol, XLogP of 2.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S,5R)-5-ethyl-3,3-difluoro-4-methylthiolan-2-ol is sourced from PubChem (CID 159789997), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).