C15H23BrSi — CID 159790681
[(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane (PubChem CID 159790681) has the molecular formula C15H23BrSi and a molecular weight of 311.34 g/mol. Its IUPAC name is [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane.
| Compound Name | [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane |
|---|---|
| PubChem CID | 159790681 |
| Molecular Formula | C15H23BrSi |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane |
| SMILES | CC[SiH](CC)[C@@]1(C)CCc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C15H23BrSi/c1-4-17(5-2)15(3)9-8-12-6-7-14(16)10-13(12)11-15/h6-7,10,17H,4-5,8-9,11H2,1-3H3/t15-/m0/s1 |
| InChIKey | NINAUFKGGYMWQR-HNNXBMFYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|