About [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane
[(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane (PubChem CID 159790681) has the molecular formula C15H23BrSi
and a molecular weight of 311.34 g/mol. Its IUPAC name is [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane.
Molecular Properties
| Compound Name | [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane |
| PubChem CID | 159790681 |
| Molecular Formula | C15H23BrSi |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 310.08 |
| IUPAC Name | [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane |
| SMILES | CC[SiH](CC)[C@@]1(C)CCc2ccc(Br)cc2C1 |
| InChI | InChI=1S/C15H23BrSi/c1-4-17(5-2)15(3)9-8-12-6-7-14(16)10-13(12)11-15/h6-7,10,17H,4-5,8-9,11H2,1-3H3/t15-/m0/s1 |
| InChIKey | NINAUFKGGYMWQR-HNNXBMFYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane?
The IUPAC name of [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane (CID 159790681) is [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane.
What is the SMILES notation for [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane?
The canonical SMILES for [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane is CC[SiH](CC)[C@@]1(C)CCc2ccc(Br)cc2C1.
What is the InChIKey of [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane?
The InChIKey is NINAUFKGGYMWQR-HNNXBMFYSA-N. The full InChI is InChI=1S/C15H23BrSi/c1-4-17(5-2)15(3)9-8-12-6-7-14(16)10-13(12)11-15/h6-7,10,17H,4-5,8-9,11H2,1-3H3/t15-/m0/s1.
What are the key properties of [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane?
[(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane has a molecular weight of 311.34 g/mol, XLogP of 4.97, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S)-7-bromo-2-methyl-3,4-dihydro-1H-naphthalen-2-yl]-diethylsilane is sourced from PubChem (CID 159790681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).