C14H8F3NO3S — CID 159790833
1,1,1-trifluoro-N-(9-oxofluoren-1-yl)methanesulfonamide (PubChem CID 159790833) has the molecular formula C14H8F3NO3S and a molecular weight of 327.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-N-(9-oxofluoren-1-yl)methanesulfonamide.
| Compound Name | 1,1,1-trifluoro-N-(9-oxofluoren-1-yl)methanesulfonamide |
|---|---|
| PubChem CID | 159790833 |
| Molecular Formula | C14H8F3NO3S |
| Molecular Weight | 327.28 g/mol |
| Exact Mass | 327.02 |
| IUPAC Name | 1,1,1-trifluoro-N-(9-oxofluoren-1-yl)methanesulfonamide |
| SMILES | O=C1c2ccccc2-c2cccc(NS(=O)(=O)C(F)(F)F)c21 |
| InChI | InChI=1S/C14H8F3NO3S/c15-14(16,17)22(20,21)18-11-7-3-6-9-8-4-1-2-5-10(8)13(19)12(9)11/h1-7,18H |
| InChIKey | NINNEQWFKILGBP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.28 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'} |
|---|