About 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]naphthalene-1-carbonitrile
4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]naphthalene-1-carbonitrile (PubChem CID 15979280) has the molecular formula C26H16F3N3O
and a molecular weight of 443.43 g/mol. Its IUPAC name is 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]naphthalene-1-carbonitrile.
Molecular Properties
| Compound Name | 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]naphthalene-1-carbonitrile |
| PubChem CID | 15979280 |
| Molecular Formula | C26H16F3N3O |
| Molecular Weight | 443.43 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]naphthalene-1-carbonitrile |
| SMILES | N#Cc1ccc(C(O)(c2ccc3c(cnn3-c3ccccc3)c2)C(F)(F)F)c2ccccc12 |
| InChI | InChI=1S/C26H16F3N3O/c27-26(28,29)25(33,23-12-10-17(15-30)21-8-4-5-9-22(21)23)19-11-13-24-18(14-19)16-31-32(24)20-6-2-1-3-7-20/h1-14,16,33H |
| InChIKey | RLAKWQDNVXVPDW-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 61.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.43 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]naphthalene-1-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]naphthalene-1-carbonitrile?
The IUPAC name of 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]naphthalene-1-carbonitrile (CID 15979280) is 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]naphthalene-1-carbonitrile.
What is the SMILES notation for 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]naphthalene-1-carbonitrile?
The canonical SMILES for 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]naphthalene-1-carbonitrile is N#Cc1ccc(C(O)(c2ccc3c(cnn3-c3ccccc3)c2)C(F)(F)F)c2ccccc12.
What is the InChIKey of 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]naphthalene-1-carbonitrile?
The InChIKey is RLAKWQDNVXVPDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H16F3N3O/c27-26(28,29)25(33,23-12-10-17(15-30)21-8-4-5-9-22(21)23)19-11-13-24-18(14-19)16-31-32(24)20-6-2-1-3-7-20/h1-14,16,33H.
What are the key properties of 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]naphthalene-1-carbonitrile?
4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]naphthalene-1-carbonitrile has a molecular weight of 443.43 g/mol, XLogP of 5.85, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2,2,2-trifluoro-1-hydroxy-1-(1-phenylindazol-5-yl)ethyl]naphthalene-1-carbonitrile is sourced from PubChem (CID 15979280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).