C19H18ClF3N8O3S — CID 15979288
N-[1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-yl]nitramide;3-(methylsulfanylmethyl)-5-[4-(trifluoromethyl)-3-pyridinyl]-1,2,4-oxadiazole (PubChem CID 15979288) has the molecular formula C19H18ClF3N8O3S and a molecular weight of 530.92 g/mol. Its IUPAC name is N-[1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-yl]nitramide;3-(methylsulfanylmethyl)-5-[4-(trifluoromethyl)-3-pyridinyl]-1,2,4-oxadiazole.
| Compound Name | N-[1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-yl]nitramide;3-(methylsulfanylmethyl)-5-[4-(trifluoromethyl)-3-pyridinyl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 15979288 |
| Molecular Formula | C19H18ClF3N8O3S |
| Molecular Weight | 530.92 g/mol |
| Exact Mass | 530.09 |
| IUPAC Name | N-[1-[(6-chloro-3-pyridinyl)methyl]-4,5-dihydroimidazol-2-yl]nitramide;3-(methylsulfanylmethyl)-5-[4-(trifluoromethyl)-3-pyridinyl]-1,2,4-oxadiazole |
| SMILES | CSCc1noc(-c2cnccc2C(F)(F)F)n1.O=[N+]([O-])NC1=NCCN1Cc1ccc(Cl)nc1 |
| InChI | InChI=1S/C10H8F3N3OS.C9H10ClN5O2/c1-18-5-8-15-9(17-16-8)6-4-14-3-2-7(6)10(11,12)13;10-8-2-1-7(5-12-8)6-14-4-3-11-9(14)13-15(16)17/h2-4H,5H2,1H3;1-2,5H,3-4,6H2,(H,11,13) |
| InChIKey | NPLHVEPOVMQHNN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 135.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.92 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|