C12H22O4 — CID 159793073
5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal (PubChem CID 159793073) has the molecular formula C12H22O4 and a molecular weight of 230.30 g/mol. Its IUPAC name is 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal.
| Compound Name | 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal |
|---|---|
| PubChem CID | 159793073 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal |
| SMILES | CC(C)(O)CCC=O.CC1(C)CCC(=O)O1 |
| InChI | InChI=1S/C6H10O2.C6H12O2/c1-6(2)4-3-5(7)8-6;1-6(2,8)4-3-5-7/h3-4H2,1-2H3;5,8H,3-4H2,1-2H3 |
| InChIKey | NIUXNYGEDXUGHY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|