About 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal
5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal (PubChem CID 159793073) has the molecular formula C12H22O4
and a molecular weight of 230.30 g/mol. Its IUPAC name is 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal.
Molecular Properties
| Compound Name | 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal |
| PubChem CID | 159793073 |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.15 |
| IUPAC Name | 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal |
| SMILES | CC(C)(O)CCC=O.CC1(C)CCC(=O)O1 |
| InChI | InChI=1S/C6H10O2.C6H12O2/c1-6(2)4-3-5(7)8-6;1-6(2,8)4-3-5-7/h3-4H2,1-2H3;5,8H,3-4H2,1-2H3 |
| InChIKey | NIUXNYGEDXUGHY-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal?
The IUPAC name of 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal (CID 159793073) is 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal.
What is the SMILES notation for 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal?
The canonical SMILES for 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal is CC(C)(O)CCC=O.CC1(C)CCC(=O)O1.
What is the InChIKey of 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal?
The InChIKey is NIUXNYGEDXUGHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O2.C6H12O2/c1-6(2)4-3-5(7)8-6;1-6(2,8)4-3-5-7/h3-4H2,1-2H3;5,8H,3-4H2,1-2H3.
What are the key properties of 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal?
5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal has a molecular weight of 230.30 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyloxolan-2-one;4-hydroxy-4-methylpentanal is sourced from PubChem (CID 159793073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).