C27H23F3N4O2 — CID 159794604
11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one (PubChem CID 159794604) has the molecular formula C27H23F3N4O2 and a molecular weight of 492.50 g/mol. Its IUPAC name is 11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one.
| Compound Name | 11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one |
|---|---|
| PubChem CID | 159794604 |
| Molecular Formula | C27H23F3N4O2 |
| Molecular Weight | 492.50 g/mol |
| Exact Mass | 492.18 |
| IUPAC Name | 11-[4-hydroxy-3-(trifluoromethyl)phenyl]-16-methyl-5-piperidin-1-yl-8,12,14-triazatetracyclo[8.7.0.02,7.013,17]heptadeca-1(17),2(7),3,5,10,12,15-heptaen-9-one |
| SMILES | Cc1c[nH]c2nc(-c3ccc(O)c(C(F)(F)F)c3)c3c(=O)[nH]c4cc(N5CCCCC5)ccc4c3c12 |
| InChI | InChI=1S/C27H23F3N4O2/c1-14-13-31-25-21(14)22-17-7-6-16(34-9-3-2-4-10-34)12-19(17)32-26(36)23(22)24(33-25)15-5-8-20(35)18(11-15)27(28,29)30/h5-8,11-13,35H,2-4,9-10H2,1H3,(H,31,33)(H,32,36) |
| InChIKey | UZPPPXCGAPGDFI-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 85.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.50 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|