C11H7F11N2 — CID 15979539
2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-(3,3,3-trifluoropropyl)propanedinitrile (PubChem CID 15979539) has the molecular formula C11H7F11N2 and a molecular weight of 376.17 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-(3,3,3-trifluoropropyl)propanedinitrile.
| Compound Name | 2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-(3,3,3-trifluoropropyl)propanedinitrile |
|---|---|
| PubChem CID | 15979539 |
| Molecular Formula | C11H7F11N2 |
| Molecular Weight | 376.17 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5-octafluoropentyl)-2-(3,3,3-trifluoropropyl)propanedinitrile |
| SMILES | N#CC(C#N)(CCC(F)(F)F)CC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C11H7F11N2/c12-6(13)10(19,20)11(21,22)8(14,15)3-7(4-23,5-24)1-2-9(16,17)18/h6H,1-3H2 |
| InChIKey | MEQLNUTUGWFNIB-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.17 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|