C13H7F15N2 — CID 15979556
2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)-2-(3,3,3-trifluoropropyl)propanedinitrile (PubChem CID 15979556) has the molecular formula C13H7F15N2 and a molecular weight of 476.18 g/mol. Its IUPAC name is 2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)-2-(3,3,3-trifluoropropyl)propanedinitrile.
| Compound Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)-2-(3,3,3-trifluoropropyl)propanedinitrile |
|---|---|
| PubChem CID | 15979556 |
| Molecular Formula | C13H7F15N2 |
| Molecular Weight | 476.18 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 2-(2,2,3,3,4,4,5,5,6,6,7,7-dodecafluoroheptyl)-2-(3,3,3-trifluoropropyl)propanedinitrile |
| SMILES | N#CC(C#N)(CCC(F)(F)F)CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H7F15N2/c14-6(15)10(21,22)12(25,26)13(27,28)11(23,24)8(16,17)3-7(4-29,5-30)1-2-9(18,19)20/h6H,1-3H2 |
| InChIKey | FCHOIFNRIRAWLF-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.18 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|